C19H28N4O3 — CID 138688827
tert-butyl N-[5-amino-5-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]carbamate (PubChem CID 138688827) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is tert-butyl N-[5-amino-5-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]carbamate.
| Compound Name | tert-butyl N-[5-amino-5-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]carbamate |
|---|---|
| PubChem CID | 138688827 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | tert-butyl N-[5-amino-5-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(N)c1nc(Cc2ccccc2)no1 |
| InChI | InChI=1S/C19H28N4O3/c1-19(2,3)25-18(24)21-12-8-7-11-15(20)17-22-16(23-26-17)13-14-9-5-4-6-10-14/h4-6,9-10,15H,7-8,11-13,20H2,1-3H3,(H,21,24) |
| InChIKey | JODULJGKOYNKBS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|