C26H34N4O6S — CID 138688825
[(1S)-1-amino-1-(3-benzyl-1,2,4-oxadiazol-5-yl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] 4-methylbenzenesulfonate (PubChem CID 138688825) has the molecular formula C26H34N4O6S and a molecular weight of 530.65 g/mol. Its IUPAC name is [(1S)-1-amino-1-(3-benzyl-1,2,4-oxadiazol-5-yl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S)-1-amino-1-(3-benzyl-1,2,4-oxadiazol-5-yl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 138688825 |
| Molecular Formula | C26H34N4O6S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | [(1S)-1-amino-1-(3-benzyl-1,2,4-oxadiazol-5-yl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@](N)(CCCCNC(=O)OC(C)(C)C)c2nc(Cc3ccccc3)no2)cc1 |
| InChI | InChI=1S/C26H34N4O6S/c1-19-12-14-21(15-13-19)37(32,33)36-26(27,16-8-9-17-28-24(31)34-25(2,3)4)23-29-22(30-35-23)18-20-10-6-5-7-11-20/h5-7,10-15H,8-9,16-18,27H2,1-4H3,(H,28,31)/t26-/m0/s1 |
| InChIKey | RDQMUEWOCFUZRZ-SANMLTNESA-N |
| XLogP | 4.18 |
| TPSA | 146.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|