C20H34N4O5 — CID 138689080
[(1S)-1-amino-1-[3-(cyclohexylmethyl)-1,2,4-oxadiazol-5-yl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] acetate (PubChem CID 138689080) has the molecular formula C20H34N4O5 and a molecular weight of 410.52 g/mol. Its IUPAC name is [(1S)-1-amino-1-[3-(cyclohexylmethyl)-1,2,4-oxadiazol-5-yl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] acetate.
| Compound Name | [(1S)-1-amino-1-[3-(cyclohexylmethyl)-1,2,4-oxadiazol-5-yl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] acetate |
|---|---|
| PubChem CID | 138689080 |
| Molecular Formula | C20H34N4O5 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | [(1S)-1-amino-1-[3-(cyclohexylmethyl)-1,2,4-oxadiazol-5-yl]-4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] acetate |
| SMILES | CC(=O)O[C@@](N)(CCCNC(=O)OC(C)(C)C)c1nc(CC2CCCCC2)no1 |
| InChI | InChI=1S/C20H34N4O5/c1-14(25)27-20(21,11-8-12-22-18(26)28-19(2,3)4)17-23-16(24-29-17)13-15-9-6-5-7-10-15/h15H,5-13,21H2,1-4H3,(H,22,26)/t20-/m0/s1 |
| InChIKey | PIJNETBRGQSZNS-FQEVSTJZSA-N |
| XLogP | 3.17 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|