C22H35N3O4 — CID 56965834
tert-butyl N-[[3-(dicyclohexylcarbamoyl)-1,2-oxazol-5-yl]methyl]carbamate (PubChem CID 56965834) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is tert-butyl N-[[3-(dicyclohexylcarbamoyl)-1,2-oxazol-5-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(dicyclohexylcarbamoyl)-1,2-oxazol-5-yl]methyl]carbamate |
|---|---|
| PubChem CID | 56965834 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | tert-butyl N-[[3-(dicyclohexylcarbamoyl)-1,2-oxazol-5-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(C(=O)N(C2CCCCC2)C2CCCCC2)no1 |
| InChI | InChI=1S/C22H35N3O4/c1-22(2,3)28-21(27)23-15-18-14-19(24-29-18)20(26)25(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h14,16-17H,4-13,15H2,1-3H3,(H,23,27) |
| InChIKey | NSRPIAGKCDMXHT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |