C21H35N3O2 — CID 56955976
N,N-dicyclohexyl-5-(diethylaminomethyl)-1,2-oxazole-3-carboxamide (PubChem CID 56955976) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is N,N-dicyclohexyl-5-(diethylaminomethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N,N-dicyclohexyl-5-(diethylaminomethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 56955976 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | N,N-dicyclohexyl-5-(diethylaminomethyl)-1,2-oxazole-3-carboxamide |
| SMILES | CCN(CC)Cc1cc(C(=O)N(C2CCCCC2)C2CCCCC2)no1 |
| InChI | InChI=1S/C21H35N3O2/c1-3-23(4-2)16-19-15-20(22-26-19)21(25)24(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h15,17-18H,3-14,16H2,1-2H3 |
| InChIKey | UGMBPQHGUJGEPE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |