C23H30N2O2 — CID 57339499
N,N-dicyclohexyl-5-(3-methylphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 57339499) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is N,N-dicyclohexyl-5-(3-methylphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N,N-dicyclohexyl-5-(3-methylphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 57339499 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N,N-dicyclohexyl-5-(3-methylphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cccc(-c2cc(C(=O)N(C3CCCCC3)C3CCCCC3)no2)c1 |
| InChI | InChI=1S/C23H30N2O2/c1-17-9-8-10-18(15-17)22-16-21(24-27-22)23(26)25(19-11-4-2-5-12-19)20-13-6-3-7-14-20/h8-10,15-16,19-20H,2-7,11-14H2,1H3 |
| InChIKey | NXRGRCJZTOLIHG-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |