C22H36N4O3 — CID 175525676
tert-butyl N-[5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamate (PubChem CID 175525676) has the molecular formula C22H36N4O3 and a molecular weight of 404.56 g/mol. Its IUPAC name is tert-butyl N-[5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamate.
| Compound Name | tert-butyl N-[5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamate |
|---|---|
| PubChem CID | 175525676 |
| Molecular Formula | C22H36N4O3 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | tert-butyl N-[5-[3-(1-adamantyl)-1,2,4-oxadiazol-5-yl]-5-aminopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(N)c1nc(C23CC4CC(CC(C4)C2)C3)no1 |
| InChI | InChI=1S/C22H36N4O3/c1-21(2,3)28-20(27)24-7-5-4-6-17(23)18-25-19(26-29-18)22-11-14-8-15(12-22)10-16(9-14)13-22/h14-17H,4-13,23H2,1-3H3,(H,24,27) |
| InChIKey | GZSOLNDZWHNFBU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|