C24H24N4O2 — CID 135928164
(9S)-9-[(E)-2-phenylethenyl]-3-piperidin-1-yl-2,8,9,10-tetrahydropyrimido[4,5-c]isoquinoline-1,7-dione (PubChem CID 135928164) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is (9S)-9-[(E)-2-phenylethenyl]-3-piperidin-1-yl-2,8,9,10-tetrahydropyrimido[4,5-c]isoquinoline-1,7-dione.
| Compound Name | (9S)-9-[(E)-2-phenylethenyl]-3-piperidin-1-yl-2,8,9,10-tetrahydropyrimido[4,5-c]isoquinoline-1,7-dione |
|---|---|
| PubChem CID | 135928164 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (9S)-9-[(E)-2-phenylethenyl]-3-piperidin-1-yl-2,8,9,10-tetrahydropyrimido[4,5-c]isoquinoline-1,7-dione |
| SMILES | O=C1C[C@@H](/C=C/c2ccccc2)Cc2c1cnc1nc(N3CCCCC3)[nH]c(=O)c21 |
| InChI | InChI=1S/C24H24N4O2/c29-20-14-17(10-9-16-7-3-1-4-8-16)13-18-19(20)15-25-22-21(18)23(30)27-24(26-22)28-11-5-2-6-12-28/h1,3-4,7-10,15,17H,2,5-6,11-14H2,(H,25,26,27,30)/b10-9+/t17-/m0/s1 |
| InChIKey | JYSWZGFRBWCKAY-FVNWOWOISA-N |
| XLogP | 3.77 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |