C23H23NO2 — CID 168796540
2-methyl-3-(4-phenylmethoxyphenyl)-5,6,7,8-tetrahydro-1H-quinolin-4-one (PubChem CID 168796540) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-methyl-3-(4-phenylmethoxyphenyl)-5,6,7,8-tetrahydro-1H-quinolin-4-one.
| Compound Name | 2-methyl-3-(4-phenylmethoxyphenyl)-5,6,7,8-tetrahydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 168796540 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-methyl-3-(4-phenylmethoxyphenyl)-5,6,7,8-tetrahydro-1H-quinolin-4-one |
| SMILES | Cc1[nH]c2c(c(=O)c1-c1ccc(OCc3ccccc3)cc1)CCCC2 |
| InChI | InChI=1S/C23H23NO2/c1-16-22(23(25)20-9-5-6-10-21(20)24-16)18-11-13-19(14-12-18)26-15-17-7-3-2-4-8-17/h2-4,7-8,11-14H,5-6,9-10,15H2,1H3,(H,24,25) |
| InChIKey | PWFNUJWSNCPIIL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |