C14H14Cl2N4O — CID 162327470
2-amino-6-methyl-5-pyridin-4-yl-3H-quinazolin-4-one;dihydrochloride (PubChem CID 162327470) has the molecular formula C14H14Cl2N4O and a molecular weight of 325.20 g/mol. Its IUPAC name is 2-amino-6-methyl-5-pyridin-4-yl-3H-quinazolin-4-one;dihydrochloride.
| Compound Name | 2-amino-6-methyl-5-pyridin-4-yl-3H-quinazolin-4-one;dihydrochloride |
|---|---|
| PubChem CID | 162327470 |
| Molecular Formula | C14H14Cl2N4O |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-amino-6-methyl-5-pyridin-4-yl-3H-quinazolin-4-one;dihydrochloride |
| SMILES | Cc1ccc2nc(N)[nH]c(=O)c2c1-c1ccncc1.Cl.Cl |
| InChI | InChI=1S/C14H12N4O.2ClH/c1-8-2-3-10-12(13(19)18-14(15)17-10)11(8)9-4-6-16-7-5-9;;/h2-7H,1H3,(H3,15,17,18,19);2*1H |
| InChIKey | XBQMOBIKBVWVRB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |