C15H15N4O+ — CID 135710682
2-amino-5,7-dimethyl-8-phenyl-3H-pyrido[2,3-d]pyrimidin-8-ium-4-one (PubChem CID 135710682) has the molecular formula C15H15N4O+ and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-amino-5,7-dimethyl-8-phenyl-3H-pyrido[2,3-d]pyrimidin-8-ium-4-one.
| Compound Name | 2-amino-5,7-dimethyl-8-phenyl-3H-pyrido[2,3-d]pyrimidin-8-ium-4-one |
|---|---|
| PubChem CID | 135710682 |
| Molecular Formula | C15H15N4O+ |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-amino-5,7-dimethyl-8-phenyl-3H-pyrido[2,3-d]pyrimidin-8-ium-4-one |
| SMILES | Cc1cc(C)[n+](-c2ccccc2)c2nc(N)[nH]c(=O)c12 |
| InChI | InChI=1S/C15H14N4O/c1-9-8-10(2)19(11-6-4-3-5-7-11)13-12(9)14(20)18-15(16)17-13/h3-8H,1-2H3,(H2,16,18,20)/p+1 |
| InChIKey | ZNKAUFUEYRFGPB-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|