C10H10N4O — CID 135448367
2,4-diamino-5-phenyl-1H-pyrimidin-6-one (PubChem CID 135448367) has the molecular formula C10H10N4O and a molecular weight of 202.22 g/mol. Its IUPAC name is 2,4-diamino-5-phenyl-1H-pyrimidin-6-one.
| Compound Name | 2,4-diamino-5-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135448367 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2,4-diamino-5-phenyl-1H-pyrimidin-6-one |
| SMILES | Nc1nc(N)c(-c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H10N4O/c11-8-7(6-4-2-1-3-5-6)9(15)14-10(12)13-8/h1-5H,(H5,11,12,13,14,15) |
| InChIKey | XXXWUVLTYKKMKI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |