About 4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine
4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine (PubChem CID 6538872) has the molecular formula C29H21N5
and a molecular weight of 439.52 g/mol. Its IUPAC name is 4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine.
Molecular Properties
| Compound Name | 4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine |
| PubChem CID | 6538872 |
| Molecular Formula | C29H21N5 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine |
| SMILES | Nc1[nH]nc2nnc(-c3ccc(-c4ccccc4)cc3)c(-c3ccc(-c4ccccc4)cc3)c12 |
| InChI | InChI=1S/C29H21N5/c30-28-26-25(23-15-11-21(12-16-23)19-7-3-1-4-8-19)27(31-33-29(26)34-32-28)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18H,(H3,30,32,33,34) |
| InChIKey | KQMSZRUMQWJYMW-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine?
The IUPAC name of 4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine (CID 6538872) is 4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine.
What is the SMILES notation for 4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine?
The canonical SMILES for 4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine is Nc1[nH]nc2nnc(-c3ccc(-c4ccccc4)cc3)c(-c3ccc(-c4ccccc4)cc3)c12.
What is the InChIKey of 4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine?
The InChIKey is KQMSZRUMQWJYMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H21N5/c30-28-26-25(23-15-11-21(12-16-23)19-7-3-1-4-8-19)27(31-33-29(26)34-32-28)24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18H,(H3,30,32,33,34).
What are the key properties of 4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine?
4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine has a molecular weight of 439.52 g/mol, XLogP of 6.60, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(4-phenylphenyl)-2H-pyrazolo[3,4-c]pyridazin-3-amine is sourced from PubChem (CID 6538872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).