C18H12N6 — CID 67042503
3-(3-amino-4-phenyl-1H-pyrazolo[3,4-c]pyridazin-5-yl)benzonitrile (PubChem CID 67042503) has the molecular formula C18H12N6 and a molecular weight of 312.34 g/mol. Its IUPAC name is 3-(3-amino-4-phenyl-1H-pyrazolo[3,4-c]pyridazin-5-yl)benzonitrile.
| Compound Name | 3-(3-amino-4-phenyl-1H-pyrazolo[3,4-c]pyridazin-5-yl)benzonitrile |
|---|---|
| PubChem CID | 67042503 |
| Molecular Formula | C18H12N6 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-(3-amino-4-phenyl-1H-pyrazolo[3,4-c]pyridazin-5-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2nnc3[nH]nc(N)c3c2-c2ccccc2)c1 |
| InChI | InChI=1S/C18H12N6/c19-10-11-5-4-8-13(9-11)16-14(12-6-2-1-3-7-12)15-17(20)22-24-18(15)23-21-16/h1-9H,(H3,20,22,23,24) |
| InChIKey | TXXVFAPDJYIMHK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |