C23H17N5O3 — CID 46872791
11,13-dimethyl-5,6-diphenyl-3,4,9,11,13-pentazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6-tetraene-8,12,14-trione (PubChem CID 46872791) has the molecular formula C23H17N5O3 and a molecular weight of 411.42 g/mol. Its IUPAC name is 11,13-dimethyl-5,6-diphenyl-3,4,9,11,13-pentazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6-tetraene-8,12,14-trione.
| Compound Name | 11,13-dimethyl-5,6-diphenyl-3,4,9,11,13-pentazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6-tetraene-8,12,14-trione |
|---|---|
| PubChem CID | 46872791 |
| Molecular Formula | C23H17N5O3 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 11,13-dimethyl-5,6-diphenyl-3,4,9,11,13-pentazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6-tetraene-8,12,14-trione |
| SMILES | Cn1c(=O)c2c3nnc(-c4ccccc4)c(-c4ccccc4)c3c(=O)[nH]c2n(C)c1=O |
| InChI | InChI=1S/C23H17N5O3/c1-27-20-17(22(30)28(2)23(27)31)19-16(21(29)24-20)15(13-9-5-3-6-10-13)18(25-26-19)14-11-7-4-8-12-14/h3-12H,1-2H3,(H,24,29) |
| InChIKey | KFZBGDFMHAPDTB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|