C22H15N3O4 — CID 146036446
14,16-dimethyl-11-phenyl-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17)-hexaene-9,13,15-trione (PubChem CID 146036446) has the molecular formula C22H15N3O4 and a molecular weight of 385.38 g/mol. Its IUPAC name is 14,16-dimethyl-11-phenyl-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17)-hexaene-9,13,15-trione.
| Compound Name | 14,16-dimethyl-11-phenyl-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17)-hexaene-9,13,15-trione |
|---|---|
| PubChem CID | 146036446 |
| Molecular Formula | C22H15N3O4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 14,16-dimethyl-11-phenyl-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(18),2,4,6,10,12(17)-hexaene-9,13,15-trione |
| SMILES | Cn1c(=O)c2c(-c3ccccc3)c3c(=O)oc4ccccc4c3nc2n(C)c1=O |
| InChI | InChI=1S/C22H15N3O4/c1-24-19-17(20(26)25(2)22(24)28)15(12-8-4-3-5-9-12)16-18(23-19)13-10-6-7-11-14(13)29-21(16)27/h3-11H,1-2H3 |
| InChIKey | BHCPAGWJGAHOCO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|