C22H17N5O2 — CID 133064236
3,5-dimethyl-11,12-diphenyl-3,5,8,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione (PubChem CID 133064236) has the molecular formula C22H17N5O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 3,5-dimethyl-11,12-diphenyl-3,5,8,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione.
| Compound Name | 3,5-dimethyl-11,12-diphenyl-3,5,8,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione |
|---|---|
| PubChem CID | 133064236 |
| Molecular Formula | C22H17N5O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3,5-dimethyl-11,12-diphenyl-3,5,8,10,13-pentazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-4,6-dione |
| SMILES | Cn1c(=O)c2[nH]c3nc(-c4ccccc4)c(-c4ccccc4)nc3c2n(C)c1=O |
| InChI | InChI=1S/C22H17N5O2/c1-26-19-17-20(25-18(19)21(28)27(2)22(26)29)24-16(14-11-7-4-8-12-14)15(23-17)13-9-5-3-6-10-13/h3-12H,1-2H3,(H,24,25) |
| InChIKey | QKTSPPRBQWUIQE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |