C18H12ClN3O — CID 127035059
5-chloro-1-methyl-3-phenylpyrido[2,3-g]quinoxalin-2-one (PubChem CID 127035059) has the molecular formula C18H12ClN3O and a molecular weight of 321.77 g/mol. Its IUPAC name is 5-chloro-1-methyl-3-phenylpyrido[2,3-g]quinoxalin-2-one.
| Compound Name | 5-chloro-1-methyl-3-phenylpyrido[2,3-g]quinoxalin-2-one |
|---|---|
| PubChem CID | 127035059 |
| Molecular Formula | C18H12ClN3O |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 5-chloro-1-methyl-3-phenylpyrido[2,3-g]quinoxalin-2-one |
| SMILES | Cn1c(=O)c(-c2ccccc2)nc2c(Cl)c3ncccc3cc21 |
| InChI | InChI=1S/C18H12ClN3O/c1-22-13-10-12-8-5-9-20-15(12)14(19)17(13)21-16(18(22)23)11-6-3-2-4-7-11/h2-10H,1H3 |
| InChIKey | AWAKVPKQMFDFHV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|