C15H11N3O — CID 101374170
8-methyl-1,3,8-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12,14,16-heptaen-9-one (PubChem CID 101374170) has the molecular formula C15H11N3O and a molecular weight of 249.27 g/mol. Its IUPAC name is 8-methyl-1,3,8-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12,14,16-heptaen-9-one.
| Compound Name | 8-methyl-1,3,8-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12,14,16-heptaen-9-one |
|---|---|
| PubChem CID | 101374170 |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 8-methyl-1,3,8-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12,14,16-heptaen-9-one |
| SMILES | Cn1c(=O)c2cc3ccccc3n2c2ncccc21 |
| InChI | InChI=1S/C15H11N3O/c1-17-12-7-4-8-16-14(12)18-11-6-3-2-5-10(11)9-13(18)15(17)19/h2-9H,1H3 |
| InChIKey | YSKGZSFOFXSPCZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |