C12H9N5OS — CID 1280813
8-methyl-11-methylimino-13-oxo-12-thia-1,6,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,9-tetraene-10-carbonitrile (PubChem CID 1280813) has the molecular formula C12H9N5OS and a molecular weight of 271.31 g/mol. Its IUPAC name is 8-methyl-11-methylimino-13-oxo-12-thia-1,6,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,9-tetraene-10-carbonitrile.
| Compound Name | 8-methyl-11-methylimino-13-oxo-12-thia-1,6,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,9-tetraene-10-carbonitrile |
|---|---|
| PubChem CID | 1280813 |
| Molecular Formula | C12H9N5OS |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 8-methyl-11-methylimino-13-oxo-12-thia-1,6,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,9-tetraene-10-carbonitrile |
| SMILES | C/N=c1\sc(=O)n2c3cccnc3n(C)c2c1C#N |
| InChI | InChI=1S/C12H9N5OS/c1-14-10-7(6-13)11-16(2)9-8(4-3-5-15-9)17(11)12(18)19-10/h3-5H,1-2H3/b14-10- |
| InChIKey | BMQJGKKKQXPUKT-UVTDQMKNSA-N |
| XLogP | 0.65 |
| TPSA | 75.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |