About 1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone
1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone (PubChem CID 57399923) has the molecular formula C11H7ClN4O
and a molecular weight of 246.66 g/mol. Its IUPAC name is 1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone |
| PubChem CID | 57399923 |
| Molecular Formula | C11H7ClN4O |
| Molecular Weight | 246.66 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone |
| SMILES | CC(=O)n1nnc2c(Cl)c3ncccc3cc21 |
| InChI | InChI=1S/C11H7ClN4O/c1-6(17)16-8-5-7-3-2-4-13-10(7)9(12)11(8)14-15-16/h2-5H,1H3 |
| InChIKey | RJYQLBSKDCOAQO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone?
The IUPAC name of 1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone (CID 57399923) is 1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone.
What is the SMILES notation for 1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone?
The canonical SMILES for 1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone is CC(=O)n1nnc2c(Cl)c3ncccc3cc21.
What is the InChIKey of 1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone?
The InChIKey is RJYQLBSKDCOAQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClN4O/c1-6(17)16-8-5-7-3-2-4-13-10(7)9(12)11(8)14-15-16/h2-5H,1H3.
What are the key properties of 1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone?
1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone has a molecular weight of 246.66 g/mol, XLogP of 2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorotriazolo[4,5-g]quinolin-1-yl)ethanone is sourced from PubChem (CID 57399923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).