About 1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+)
1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+) (PubChem CID 175823591) has the molecular formula C16H12N2O2Pd+2
and a molecular weight of 370.70 g/mol. Its IUPAC name is 1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+).
Molecular Properties
| Compound Name | 1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+) |
| PubChem CID | 175823591 |
| Molecular Formula | C16H12N2O2Pd+2 |
| Molecular Weight | 370.70 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+) |
| SMILES | CC(=O)c1cc2ccc3cccnc3c2nc1C(C)=O.[Pd+2] |
| InChI | InChI=1S/C16H12N2O2.Pd/c1-9(19)13-8-12-6-5-11-4-3-7-17-15(11)16(12)18-14(13)10(2)20;/h3-8H,1-2H3;/q;+2 |
| InChIKey | JEIJANVHQCZHCF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.70 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+)?
The IUPAC name of 1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+) (CID 175823591) is 1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+).
What is the SMILES notation for 1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+)?
The canonical SMILES for 1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+) is CC(=O)c1cc2ccc3cccnc3c2nc1C(C)=O.[Pd+2].
What is the InChIKey of 1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+)?
The InChIKey is JEIJANVHQCZHCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O2.Pd/c1-9(19)13-8-12-6-5-11-4-3-7-17-15(11)16(12)18-14(13)10(2)20;/h3-8H,1-2H3;/q;+2.
What are the key properties of 1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+)?
1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+) has a molecular weight of 370.70 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-acetyl-1,10-phenanthrolin-3-yl)ethanone;palladium(2+) is sourced from PubChem (CID 175823591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).