C32H18N4O4 — CID 118448774
4,6-bis(1,10-phenanthrolin-2-yl)benzene-1,3-dicarboxylic acid (PubChem CID 118448774) has the molecular formula C32H18N4O4 and a molecular weight of 522.52 g/mol. Its IUPAC name is 4,6-bis(1,10-phenanthrolin-2-yl)benzene-1,3-dicarboxylic acid.
| Compound Name | 4,6-bis(1,10-phenanthrolin-2-yl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 118448774 |
| Molecular Formula | C32H18N4O4 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 4,6-bis(1,10-phenanthrolin-2-yl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c(-c2ccc3ccc4cccnc4c3n2)cc1-c1ccc2ccc3cccnc3c2n1 |
| InChI | InChI=1S/C32H18N4O4/c37-31(38)23-16-24(32(39)40)22(26-12-10-20-8-6-18-4-2-14-34-28(18)30(20)36-26)15-21(23)25-11-9-19-7-5-17-3-1-13-33-27(17)29(19)35-25/h1-16H,(H,37,38)(H,39,40) |
| InChIKey | MQEAZOJQTBCVKM-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 126.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|