About dichlorocopper;hydrogen peroxide;1,10-phenanthroline
dichlorocopper;hydrogen peroxide;1,10-phenanthroline (PubChem CID 158916437) has the molecular formula C12H10Cl2CuN2O2
and a molecular weight of 348.68 g/mol. Its IUPAC name is dichlorocopper;hydrogen peroxide;1,10-phenanthroline.
Molecular Properties
| Compound Name | dichlorocopper;hydrogen peroxide;1,10-phenanthroline |
| PubChem CID | 158916437 |
| Molecular Formula | C12H10Cl2CuN2O2 |
| Molecular Weight | 348.68 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | dichlorocopper;hydrogen peroxide;1,10-phenanthroline |
| SMILES | Cl[Cu]Cl.OO.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.2ClH.Cu.H2O2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;;;;1-2/h1-8H;2*1H;;1-2H/q;;;+2;/p-2 |
| InChIKey | JHHCCHQUSVRZTF-UHFFFAOYSA-L |
| XLogP | 4.18 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.68 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze dichlorocopper;hydrogen peroxide;1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocopper;hydrogen peroxide;1,10-phenanthroline?
The IUPAC name of dichlorocopper;hydrogen peroxide;1,10-phenanthroline (CID 158916437) is dichlorocopper;hydrogen peroxide;1,10-phenanthroline.
What is the SMILES notation for dichlorocopper;hydrogen peroxide;1,10-phenanthroline?
The canonical SMILES for dichlorocopper;hydrogen peroxide;1,10-phenanthroline is Cl[Cu]Cl.OO.c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of dichlorocopper;hydrogen peroxide;1,10-phenanthroline?
The InChIKey is JHHCCHQUSVRZTF-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H8N2.2ClH.Cu.H2O2/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;;;;1-2/h1-8H;2*1H;;1-2H/q;;;+2;/p-2.
What are the key properties of dichlorocopper;hydrogen peroxide;1,10-phenanthroline?
dichlorocopper;hydrogen peroxide;1,10-phenanthroline has a molecular weight of 348.68 g/mol, XLogP of 4.18, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocopper;hydrogen peroxide;1,10-phenanthroline is sourced from PubChem (CID 158916437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).