C12H8ClN3 — CID 90121840
N-chloro-1,10-phenanthrolin-2-amine (PubChem CID 90121840) has the molecular formula C12H8ClN3 and a molecular weight of 229.67 g/mol. Its IUPAC name is N-chloro-1,10-phenanthrolin-2-amine.
| Compound Name | N-chloro-1,10-phenanthrolin-2-amine |
|---|---|
| PubChem CID | 90121840 |
| Molecular Formula | C12H8ClN3 |
| Molecular Weight | 229.67 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | N-chloro-1,10-phenanthrolin-2-amine |
| SMILES | ClNc1ccc2ccc3cccnc3c2n1 |
| InChI | InChI=1S/C12H8ClN3/c13-16-10-6-5-9-4-3-8-2-1-7-14-11(8)12(9)15-10/h1-7H,(H,15,16) |
| InChIKey | YXILQWOEVQSFHU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.67 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|