C18H13N3 — CID 132850503
N-phenyl-1,10-phenanthrolin-2-amine (PubChem CID 132850503) has the molecular formula C18H13N3 and a molecular weight of 271.32 g/mol. Its IUPAC name is N-phenyl-1,10-phenanthrolin-2-amine.
| Compound Name | N-phenyl-1,10-phenanthrolin-2-amine |
|---|---|
| PubChem CID | 132850503 |
| Molecular Formula | C18H13N3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-phenyl-1,10-phenanthrolin-2-amine |
| SMILES | c1ccc(Nc2ccc3ccc4cccnc4c3n2)cc1 |
| InChI | InChI=1S/C18H13N3/c1-2-6-15(7-3-1)20-16-11-10-14-9-8-13-5-4-12-19-17(13)18(14)21-16/h1-12H,(H,20,21) |
| InChIKey | NBSXXPJIAYWGLB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|