C15H16N4 — CID 132938270
N'-(1,10-phenanthrolin-2-yl)propane-1,3-diamine (PubChem CID 132938270) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is N'-(1,10-phenanthrolin-2-yl)propane-1,3-diamine.
| Compound Name | N'-(1,10-phenanthrolin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 132938270 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | N'-(1,10-phenanthrolin-2-yl)propane-1,3-diamine |
| SMILES | NCCCNc1ccc2ccc3cccnc3c2n1 |
| InChI | InChI=1S/C15H16N4/c16-8-2-10-17-13-7-6-12-5-4-11-3-1-9-18-14(11)15(12)19-13/h1,3-7,9H,2,8,10,16H2,(H,17,19) |
| InChIKey | WRZSMCFIVISVFI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|