C48H28N6O8S2 — CID 130369744
[3-(1,10-phenanthrolin-2-yl)-5-[9-[3-(1,10-phenanthrolin-2-yl)-5-sulfooxyphenyl]-1,10-phenanthrolin-2-yl]phenyl] hydrogen sulfate (PubChem CID 130369744) has the molecular formula C48H28N6O8S2 and a molecular weight of 880.92 g/mol. Its IUPAC name is [3-(1,10-phenanthrolin-2-yl)-5-[9-[3-(1,10-phenanthrolin-2-yl)-5-sulfooxyphenyl]-1,10-phenanthrolin-2-yl]phenyl] hydrogen sulfate.
| Compound Name | [3-(1,10-phenanthrolin-2-yl)-5-[9-[3-(1,10-phenanthrolin-2-yl)-5-sulfooxyphenyl]-1,10-phenanthrolin-2-yl]phenyl] hydrogen sulfate |
|---|---|
| PubChem CID | 130369744 |
| Molecular Formula | C48H28N6O8S2 |
| Molecular Weight | 880.92 g/mol |
| Exact Mass | 880.14 |
| IUPAC Name | [3-(1,10-phenanthrolin-2-yl)-5-[9-[3-(1,10-phenanthrolin-2-yl)-5-sulfooxyphenyl]-1,10-phenanthrolin-2-yl]phenyl] hydrogen sulfate |
| SMILES | O=S(=O)(O)Oc1cc(-c2ccc3ccc4cccnc4c3n2)cc(-c2ccc3ccc4ccc(-c5cc(OS(=O)(=O)O)cc(-c6ccc7ccc8cccnc8c7n6)c5)nc4c3n2)c1 |
| InChI | InChI=1S/C48H28N6O8S2/c55-63(56,57)61-37-23-33(39-15-11-29-7-5-27-3-1-19-49-43(27)45(29)51-39)21-35(25-37)41-17-13-31-9-10-32-14-18-42(54-48(32)47(31)53-41)36-22-34(24-38(26-36)62-64(58,59)60)40-16-12-30-8-6-28-4-2-20-50-44(28)46(30)52-40/h1-26H,(H,55,56,57)(H,58,59,60) |
| InChIKey | ARHJYQVBODNVNL-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 204.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.92 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|