C56H46N6O2P2 — CID 118445514
2,9-bis[3-diethylphosphoryl-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline (PubChem CID 118445514) has the molecular formula C56H46N6O2P2 and a molecular weight of 896.97 g/mol. Its IUPAC name is 2,9-bis[3-diethylphosphoryl-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline.
| Compound Name | 2,9-bis[3-diethylphosphoryl-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 118445514 |
| Molecular Formula | C56H46N6O2P2 |
| Molecular Weight | 896.97 g/mol |
| Exact Mass | 896.32 |
| IUPAC Name | 2,9-bis[3-diethylphosphoryl-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline |
| SMILES | CCP(=O)(CC)c1cc(-c2ccc3ccc4cccnc4c3n2)cc(-c2ccc3ccc4ccc(-c5cc(-c6ccc7ccc8cccnc8c7n6)cc(P(=O)(CC)CC)c5)nc4c3n2)c1 |
| InChI | InChI=1S/C56H46N6O2P2/c1-5-65(63,6-2)45-31-41(47-23-19-37-15-13-35-11-9-27-57-51(35)53(37)59-47)29-43(33-45)49-25-21-39-17-18-40-22-26-50(62-56(40)55(39)61-49)44-30-42(32-46(34-44)66(64,7-3)8-4)48-24-20-38-16-14-36-12-10-28-58-52(36)54(38)60-48/h9-34H,5-8H2,1-4H3 |
| InChIKey | YCKFXTSHSLAUOY-UHFFFAOYSA-N |
| XLogP | 13.70 |
| TPSA | 111.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.97 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|