C19H11ClN4O — CID 127034914
2-(5-chloro-2-oxo-3-phenylpyrido[2,3-g]quinoxalin-1-yl)acetonitrile (PubChem CID 127034914) has the molecular formula C19H11ClN4O and a molecular weight of 346.78 g/mol. Its IUPAC name is 2-(5-chloro-2-oxo-3-phenylpyrido[2,3-g]quinoxalin-1-yl)acetonitrile.
| Compound Name | 2-(5-chloro-2-oxo-3-phenylpyrido[2,3-g]quinoxalin-1-yl)acetonitrile |
|---|---|
| PubChem CID | 127034914 |
| Molecular Formula | C19H11ClN4O |
| Molecular Weight | 346.78 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-(5-chloro-2-oxo-3-phenylpyrido[2,3-g]quinoxalin-1-yl)acetonitrile |
| SMILES | N#CCn1c(=O)c(-c2ccccc2)nc2c(Cl)c3ncccc3cc21 |
| InChI | InChI=1S/C19H11ClN4O/c20-15-16-13(7-4-9-22-16)11-14-18(15)23-17(12-5-2-1-3-6-12)19(25)24(14)10-8-21/h1-7,9,11H,10H2 |
| InChIKey | VRZAECBVMQSKHJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.78 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|