C19H16N5O2+ — CID 110171741
1,3-dimethyl-7-phenyl-6-pyridin-1-ium-1-ylpteridine-2,4-dione (PubChem CID 110171741) has the molecular formula C19H16N5O2+ and a molecular weight of 346.37 g/mol. Its IUPAC name is 1,3-dimethyl-7-phenyl-6-pyridin-1-ium-1-ylpteridine-2,4-dione.
| Compound Name | 1,3-dimethyl-7-phenyl-6-pyridin-1-ium-1-ylpteridine-2,4-dione |
|---|---|
| PubChem CID | 110171741 |
| Molecular Formula | C19H16N5O2+ |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1,3-dimethyl-7-phenyl-6-pyridin-1-ium-1-ylpteridine-2,4-dione |
| SMILES | Cn1c(=O)c2nc(-[n+]3ccccc3)c(-c3ccccc3)nc2n(C)c1=O |
| InChI | InChI=1S/C19H16N5O2/c1-22-16-15(18(25)23(2)19(22)26)21-17(24-11-7-4-8-12-24)14(20-16)13-9-5-3-6-10-13/h3-12H,1-2H3/q+1 |
| InChIKey | PFEBEPWGOBIPJQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|