C17H17N5O3 — CID 10854551
N-[(1,3-dimethyl-2,4-dioxopteridin-6-yl)methyl]-N-phenylacetamide (PubChem CID 10854551) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is N-[(1,3-dimethyl-2,4-dioxopteridin-6-yl)methyl]-N-phenylacetamide.
| Compound Name | N-[(1,3-dimethyl-2,4-dioxopteridin-6-yl)methyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 10854551 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[(1,3-dimethyl-2,4-dioxopteridin-6-yl)methyl]-N-phenylacetamide |
| SMILES | CC(=O)N(Cc1cnc2c(n1)c(=O)n(C)c(=O)n2C)c1ccccc1 |
| InChI | InChI=1S/C17H17N5O3/c1-11(23)22(13-7-5-4-6-8-13)10-12-9-18-15-14(19-12)16(24)21(3)17(25)20(15)2/h4-9H,10H2,1-3H3 |
| InChIKey | RFLPJQHWBNTFEA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 90.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |