C16H14N4O3 — CID 110171685
1,3-dimethyl-7-phenacylpteridine-2,4-dione (PubChem CID 110171685) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is 1,3-dimethyl-7-phenacylpteridine-2,4-dione.
| Compound Name | 1,3-dimethyl-7-phenacylpteridine-2,4-dione |
|---|---|
| PubChem CID | 110171685 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1,3-dimethyl-7-phenacylpteridine-2,4-dione |
| SMILES | Cn1c(=O)c2ncc(CC(=O)c3ccccc3)nc2n(C)c1=O |
| InChI | InChI=1S/C16H14N4O3/c1-19-14-13(15(22)20(2)16(19)23)17-9-11(18-14)8-12(21)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | QTBPHMWZIXNIOC-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 86.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |