C26H28N6O3 — CID 82018565
1,3-dimethyl-7-phenacyl-8-[(4-phenylpiperazin-1-yl)methyl]purine-2,6-dione (PubChem CID 82018565) has the molecular formula C26H28N6O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is 1,3-dimethyl-7-phenacyl-8-[(4-phenylpiperazin-1-yl)methyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-phenacyl-8-[(4-phenylpiperazin-1-yl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 82018565 |
| Molecular Formula | C26H28N6O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 1,3-dimethyl-7-phenacyl-8-[(4-phenylpiperazin-1-yl)methyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(CN3CCN(c4ccccc4)CC3)n2CC(=O)c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C26H28N6O3/c1-28-24-23(25(34)29(2)26(28)35)32(17-21(33)19-9-5-3-6-10-19)22(27-24)18-30-13-15-31(16-14-30)20-11-7-4-8-12-20/h3-12H,13-18H2,1-2H3 |
| InChIKey | ZLQZGSRQLMOSFO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 85.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |