C15H12N6O2 — CID 110172068
7-anilino-1,3-dimethyl-2,4-dioxopteridine-6-carbonitrile (PubChem CID 110172068) has the molecular formula C15H12N6O2 and a molecular weight of 308.30 g/mol. Its IUPAC name is 7-anilino-1,3-dimethyl-2,4-dioxopteridine-6-carbonitrile.
| Compound Name | 7-anilino-1,3-dimethyl-2,4-dioxopteridine-6-carbonitrile |
|---|---|
| PubChem CID | 110172068 |
| Molecular Formula | C15H12N6O2 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 7-anilino-1,3-dimethyl-2,4-dioxopteridine-6-carbonitrile |
| SMILES | Cn1c(=O)c2nc(C#N)c(Nc3ccccc3)nc2n(C)c1=O |
| InChI | InChI=1S/C15H12N6O2/c1-20-13-11(14(22)21(2)15(20)23)18-10(8-16)12(19-13)17-9-6-4-3-5-7-9/h3-7H,1-2H3,(H,17,19) |
| InChIKey | LOOOHPVFQFTNKH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 105.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |