C30H48N4O2Si2 — CID 15372365
1,3-dimethyl-6,7-bis[2-tri(propan-2-yl)silylethynyl]pteridine-2,4-dione (PubChem CID 15372365) has the molecular formula C30H48N4O2Si2 and a molecular weight of 552.91 g/mol. Its IUPAC name is 1,3-dimethyl-6,7-bis[2-tri(propan-2-yl)silylethynyl]pteridine-2,4-dione.
| Compound Name | 1,3-dimethyl-6,7-bis[2-tri(propan-2-yl)silylethynyl]pteridine-2,4-dione |
|---|---|
| PubChem CID | 15372365 |
| Molecular Formula | C30H48N4O2Si2 |
| Molecular Weight | 552.91 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | 1,3-dimethyl-6,7-bis[2-tri(propan-2-yl)silylethynyl]pteridine-2,4-dione |
| SMILES | CC(C)[Si](C#Cc1nc2c(=O)n(C)c(=O)n(C)c2nc1C#C[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H48N4O2Si2/c1-19(2)37(20(3)4,21(5)6)17-15-25-26(16-18-38(22(7)8,23(9)10)24(11)12)32-28-27(31-25)29(35)34(14)30(36)33(28)13/h19-24H,1-14H3 |
| InChIKey | BLPWLUYBZNHZBV-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.91 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|