C12H9N7O2 — CID 110171650
7-imidazol-1-yl-1,3-dimethyl-2,4-dioxopteridine-6-carbonitrile (PubChem CID 110171650) has the molecular formula C12H9N7O2 and a molecular weight of 283.25 g/mol. Its IUPAC name is 7-imidazol-1-yl-1,3-dimethyl-2,4-dioxopteridine-6-carbonitrile.
| Compound Name | 7-imidazol-1-yl-1,3-dimethyl-2,4-dioxopteridine-6-carbonitrile |
|---|---|
| PubChem CID | 110171650 |
| Molecular Formula | C12H9N7O2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 7-imidazol-1-yl-1,3-dimethyl-2,4-dioxopteridine-6-carbonitrile |
| SMILES | Cn1c(=O)c2nc(C#N)c(-n3ccnc3)nc2n(C)c1=O |
| InChI | InChI=1S/C12H9N7O2/c1-17-10-8(11(20)18(2)12(17)21)15-7(5-13)9(16-10)19-4-3-14-6-19/h3-4,6H,1-2H3 |
| InChIKey | HOUSYAREURUBPQ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 111.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |