C14H11N7O2 — CID 101362136
(5,7-dimethyl-6,8-dioxo-2-phenylpyrimido[4,5-e][1,2,4]triazin-3-ylidene)cyanamide (PubChem CID 101362136) has the molecular formula C14H11N7O2 and a molecular weight of 309.29 g/mol. Its IUPAC name is (5,7-dimethyl-6,8-dioxo-2-phenylpyrimido[4,5-e][1,2,4]triazin-3-ylidene)cyanamide.
| Compound Name | (5,7-dimethyl-6,8-dioxo-2-phenylpyrimido[4,5-e][1,2,4]triazin-3-ylidene)cyanamide |
|---|---|
| PubChem CID | 101362136 |
| Molecular Formula | C14H11N7O2 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (5,7-dimethyl-6,8-dioxo-2-phenylpyrimido[4,5-e][1,2,4]triazin-3-ylidene)cyanamide |
| SMILES | Cn1c(=O)c2nn(-c3ccccc3)/c(=N/C#N)nc2n(C)c1=O |
| InChI | InChI=1S/C14H11N7O2/c1-19-11-10(12(22)20(2)14(19)23)18-21(13(17-11)16-8-15)9-6-4-3-5-7-9/h3-7H,1-2H3/b16-13+ |
| InChIKey | GDIGLCUTAYYYFS-DTQAZKPQSA-N |
| XLogP | -0.80 |
| TPSA | 110.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|