C13H13N7O2 — CID 6416712
3-(2-aminoanilino)-5,7-dimethylpyrimido[4,5-e][1,2,4]triazine-6,8-dione (PubChem CID 6416712) has the molecular formula C13H13N7O2 and a molecular weight of 299.29 g/mol. Its IUPAC name is 3-(2-aminoanilino)-5,7-dimethylpyrimido[4,5-e][1,2,4]triazine-6,8-dione.
| Compound Name | 3-(2-aminoanilino)-5,7-dimethylpyrimido[4,5-e][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 6416712 |
| Molecular Formula | C13H13N7O2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-(2-aminoanilino)-5,7-dimethylpyrimido[4,5-e][1,2,4]triazine-6,8-dione |
| SMILES | Cn1c(=O)c2nnc(Nc3ccccc3N)nc2n(C)c1=O |
| InChI | InChI=1S/C13H13N7O2/c1-19-10-9(11(21)20(2)13(19)22)17-18-12(16-10)15-8-6-4-3-5-7(8)14/h3-6H,14H2,1-2H3,(H,15,16,18) |
| InChIKey | ZBHNFPSDXBZRTM-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|