C15H15N5O2 — CID 2786085
7-amino-5-anilino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 2786085) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 7-amino-5-anilino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 7-amino-5-anilino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2786085 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 7-amino-5-anilino-1,3-dimethylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)c2c(Nc3ccccc3)cc(N)nc2n(C)c1=O |
| InChI | InChI=1S/C15H15N5O2/c1-19-13-12(14(21)20(2)15(19)22)10(8-11(16)18-13)17-9-6-4-3-5-7-9/h3-8H,1-2H3,(H3,16,17,18) |
| InChIKey | HWJDFADYPFVKIE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |