C14H13N3O2 — CID 115124313
5-(2-aminoanilino)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 115124313) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 5-(2-aminoanilino)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 5-(2-aminoanilino)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115124313 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 5-(2-aminoanilino)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2ccc(Nc3ccccc3N)cc21 |
| InChI | InChI=1S/C14H13N3O2/c1-17-12-8-9(6-7-13(12)19-14(17)18)16-11-5-3-2-4-10(11)15/h2-8,16H,15H2,1H3 |
| InChIKey | PIKPAXGFQAOSCV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 73.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|