C18H15N3O4 — CID 75478267
2-[2-[(3-methyl-2-oxo-1,3-benzoxazol-5-yl)amino]ethyl]isoindole-1,3-dione (PubChem CID 75478267) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-[2-[(3-methyl-2-oxo-1,3-benzoxazol-5-yl)amino]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(3-methyl-2-oxo-1,3-benzoxazol-5-yl)amino]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 75478267 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-[2-[(3-methyl-2-oxo-1,3-benzoxazol-5-yl)amino]ethyl]isoindole-1,3-dione |
| SMILES | Cn1c(=O)oc2ccc(NCCN3C(=O)c4ccccc4C3=O)cc21 |
| InChI | InChI=1S/C18H15N3O4/c1-20-14-10-11(6-7-15(14)25-18(20)24)19-8-9-21-16(22)12-4-2-3-5-13(12)17(21)23/h2-7,10,19H,8-9H2,1H3 |
| InChIKey | VVSYPLYBHGFRSC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|