C13H16N2O4 — CID 115233318
methyl 4-[(3-methyl-2-oxo-1,3-benzoxazol-5-yl)amino]butanoate (PubChem CID 115233318) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 4-[(3-methyl-2-oxo-1,3-benzoxazol-5-yl)amino]butanoate.
| Compound Name | methyl 4-[(3-methyl-2-oxo-1,3-benzoxazol-5-yl)amino]butanoate |
|---|---|
| PubChem CID | 115233318 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | methyl 4-[(3-methyl-2-oxo-1,3-benzoxazol-5-yl)amino]butanoate |
| SMILES | COC(=O)CCCNc1ccc2oc(=O)n(C)c2c1 |
| InChI | InChI=1S/C13H16N2O4/c1-15-10-8-9(5-6-11(10)19-13(15)17)14-7-3-4-12(16)18-2/h5-6,8,14H,3-4,7H2,1-2H3 |
| InChIKey | QEBMCHMSXPOBOV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|