C21H16N6O2 — CID 142675902
(5-benzyl-7-methyl-6,8-dioxo-2-phenyl-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene)cyanamide (PubChem CID 142675902) has the molecular formula C21H16N6O2 and a molecular weight of 384.40 g/mol. Its IUPAC name is (5-benzyl-7-methyl-6,8-dioxo-2-phenyl-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene)cyanamide.
| Compound Name | (5-benzyl-7-methyl-6,8-dioxo-2-phenyl-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene)cyanamide |
|---|---|
| PubChem CID | 142675902 |
| Molecular Formula | C21H16N6O2 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (5-benzyl-7-methyl-6,8-dioxo-2-phenyl-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene)cyanamide |
| SMILES | CN1C(=O)c2nn(-c3ccccc3)/c(=N/C#N)nc2C(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C21H16N6O2/c1-26-19(28)16(12-14-8-4-2-5-9-14)17-18(20(26)29)25-27(21(24-17)23-13-22)15-10-6-3-7-11-15/h2-11,16H,12H2,1H3/b23-21+ |
| InChIKey | MWOWQZRTBBCQLJ-XTQSDGFTSA-N |
| XLogP | 1.59 |
| TPSA | 104.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|