C29H24N6O2 — CID 142675896
[5,7-dibenzyl-2-(3-ethylphenyl)-6,8-dioxo-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene]cyanamide (PubChem CID 142675896) has the molecular formula C29H24N6O2 and a molecular weight of 488.55 g/mol. Its IUPAC name is [5,7-dibenzyl-2-(3-ethylphenyl)-6,8-dioxo-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene]cyanamide.
| Compound Name | [5,7-dibenzyl-2-(3-ethylphenyl)-6,8-dioxo-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene]cyanamide |
|---|---|
| PubChem CID | 142675896 |
| Molecular Formula | C29H24N6O2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | [5,7-dibenzyl-2-(3-ethylphenyl)-6,8-dioxo-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene]cyanamide |
| SMILES | CCc1cccc(-n2nc3c(n/c2=N\C#N)C(Cc2ccccc2)C(=O)N(Cc2ccccc2)C3=O)c1 |
| InChI | InChI=1S/C29H24N6O2/c1-2-20-14-9-15-23(16-20)35-29(31-19-30)32-25-24(17-21-10-5-3-6-11-21)27(36)34(28(37)26(25)33-35)18-22-12-7-4-8-13-22/h3-16,24H,2,17-18H2,1H3/b31-29+ |
| InChIKey | RNJHSDVIQXQBGT-OWWNRXNESA-N |
| XLogP | 3.72 |
| TPSA | 104.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|