C28H21N7O5 — CID 142675919
[5,7-dibenzyl-2-(4-methoxy-2-nitrophenyl)-6,8-dioxo-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene]cyanamide (PubChem CID 142675919) has the molecular formula C28H21N7O5 and a molecular weight of 535.52 g/mol. Its IUPAC name is [5,7-dibenzyl-2-(4-methoxy-2-nitrophenyl)-6,8-dioxo-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene]cyanamide.
| Compound Name | [5,7-dibenzyl-2-(4-methoxy-2-nitrophenyl)-6,8-dioxo-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene]cyanamide |
|---|---|
| PubChem CID | 142675919 |
| Molecular Formula | C28H21N7O5 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | [5,7-dibenzyl-2-(4-methoxy-2-nitrophenyl)-6,8-dioxo-5H-pyrido[4,3-e][1,2,4]triazin-3-ylidene]cyanamide |
| SMILES | COc1ccc(-n2nc3c(n/c2=N\C#N)C(Cc2ccccc2)C(=O)N(Cc2ccccc2)C3=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H21N7O5/c1-40-20-12-13-22(23(15-20)35(38)39)34-28(30-17-29)31-24-21(14-18-8-4-2-5-9-18)26(36)33(27(37)25(24)32-34)16-19-10-6-3-7-11-19/h2-13,15,21H,14,16H2,1H3/b30-28+ |
| InChIKey | JDSOVOTVUNCAJL-SJCQXOIGSA-N |
| XLogP | 3.07 |
| TPSA | 156.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|