C20H19N3O6 — CID 46374605
2-[(4-methoxyphenyl)methyl]-5-morpholin-4-yl-6-nitroisoindole-1,3-dione (PubChem CID 46374605) has the molecular formula C20H19N3O6 and a molecular weight of 397.39 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-5-morpholin-4-yl-6-nitroisoindole-1,3-dione.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-5-morpholin-4-yl-6-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 46374605 |
| Molecular Formula | C20H19N3O6 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-5-morpholin-4-yl-6-nitroisoindole-1,3-dione |
| SMILES | COc1ccc(CN2C(=O)c3cc(N4CCOCC4)c([N+](=O)[O-])cc3C2=O)cc1 |
| InChI | InChI=1S/C20H19N3O6/c1-28-14-4-2-13(3-5-14)12-22-19(24)15-10-17(21-6-8-29-9-7-21)18(23(26)27)11-16(15)20(22)25/h2-5,10-11H,6-9,12H2,1H3 |
| InChIKey | FMAJEAQCIQHZCL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|