C22H20BrN3O6 — CID 17220784
N-(3-bromo-4-morpholin-4-ylphenyl)-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide (PubChem CID 17220784) has the molecular formula C22H20BrN3O6 and a molecular weight of 502.32 g/mol. Its IUPAC name is N-(3-bromo-4-morpholin-4-ylphenyl)-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-(3-bromo-4-morpholin-4-ylphenyl)-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17220784 |
| Molecular Formula | C22H20BrN3O6 |
| Molecular Weight | 502.32 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | N-(3-bromo-4-morpholin-4-ylphenyl)-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide |
| SMILES | COc1ccc(-c2ccc(C(=O)Nc3ccc(N4CCOCC4)c(Br)c3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H20BrN3O6/c1-30-15-3-4-16(19(13-15)26(28)29)20-6-7-21(32-20)22(27)24-14-2-5-18(17(23)12-14)25-8-10-31-11-9-25/h2-7,12-13H,8-11H2,1H3,(H,24,27) |
| InChIKey | ZUQNJJHDHKVZGF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.32 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|