C26H27ClN4O6 — CID 17091568
N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide (PubChem CID 17091568) has the molecular formula C26H27ClN4O6 and a molecular weight of 526.98 g/mol. Its IUPAC name is N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17091568 |
| Molecular Formula | C26H27ClN4O6 |
| Molecular Weight | 526.98 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-5-(4-methoxy-2-nitrophenyl)furan-2-carboxamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(Cl)cc2NC(=O)c2ccc(-c3ccc(OC)cc3[N+](=O)[O-])o2)CC1 |
| InChI | InChI=1S/C26H27ClN4O6/c1-3-4-25(32)30-13-11-29(12-14-30)21-8-5-17(27)15-20(21)28-26(33)24-10-9-23(37-24)19-7-6-18(36-2)16-22(19)31(34)35/h5-10,15-16H,3-4,11-14H2,1-2H3,(H,28,33) |
| InChIKey | ACMRSVBBKHBGRV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.98 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|