C25H25Cl2N3O3 — CID 17091564
N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-5-(3-chlorophenyl)furan-2-carboxamide (PubChem CID 17091564) has the molecular formula C25H25Cl2N3O3 and a molecular weight of 486.40 g/mol. Its IUPAC name is N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-5-(3-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-5-(3-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17091564 |
| Molecular Formula | C25H25Cl2N3O3 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N-[2-(4-butanoylpiperazin-1-yl)-5-chlorophenyl]-5-(3-chlorophenyl)furan-2-carboxamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(Cl)cc2NC(=O)c2ccc(-c3cccc(Cl)c3)o2)CC1 |
| InChI | InChI=1S/C25H25Cl2N3O3/c1-2-4-24(31)30-13-11-29(12-14-30)21-8-7-19(27)16-20(21)28-25(32)23-10-9-22(33-23)17-5-3-6-18(26)15-17/h3,5-10,15-16H,2,4,11-14H2,1H3,(H,28,32) |
| InChIKey | YOCWRSAHYKQEKX-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |